C15H23FN4O4 — CID 46191522
(3R,9S,12R,13Z,15S)-14-fluoro-3,9,12,15-tetramethyl-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,8,11-tetrone (PubChem CID 46191522) has the molecular formula C15H23FN4O4 and a molecular weight of 342.37 g/mol. Its IUPAC name is (3R,9S,12R,13Z,15S)-14-fluoro-3,9,12,15-tetramethyl-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,8,11-tetrone.
| Compound Name | (3R,9S,12R,13Z,15S)-14-fluoro-3,9,12,15-tetramethyl-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 46191522 |
| Molecular Formula | C15H23FN4O4 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (3R,9S,12R,13Z,15S)-14-fluoro-3,9,12,15-tetramethyl-1,4,7,10-tetrazacyclopentadec-13-ene-2,5,8,11-tetrone |
| SMILES | C[C@@H]1/C=C(\F)[C@H](C)NC(=O)[C@@H](C)NC(=O)CNC(=O)[C@H](C)NC1=O |
| InChI | InChI=1S/C15H23FN4O4/c1-7-5-11(16)8(2)19-15(24)10(4)18-12(21)6-17-14(23)9(3)20-13(7)22/h5,7-10H,6H2,1-4H3,(H,17,23)(H,18,21)(H,19,24)(H,20,22)/b11-5-/t7-,8+,9+,10-/m1/s1 |
| InChIKey | AFUDKYGBXSRBQP-AMJDYDRMSA-N |
| XLogP | -0.88 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |