C22H20ClFN2O — CID 46191750
9-chloro-6-[2-(3-fluoro-4-methoxyphenyl)ethynyl]-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indole (PubChem CID 46191750) has the molecular formula C22H20ClFN2O and a molecular weight of 382.87 g/mol. Its IUPAC name is 9-chloro-6-[2-(3-fluoro-4-methoxyphenyl)ethynyl]-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indole.
| Compound Name | 9-chloro-6-[2-(3-fluoro-4-methoxyphenyl)ethynyl]-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indole |
|---|---|
| PubChem CID | 46191750 |
| Molecular Formula | C22H20ClFN2O |
| Molecular Weight | 382.87 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 9-chloro-6-[2-(3-fluoro-4-methoxyphenyl)ethynyl]-3-methyl-1,2,4,5-tetrahydroazepino[4,5-b]indole |
| SMILES | COc1ccc(C#Cn2c3c(c4cc(Cl)ccc42)CCN(C)CC3)cc1F |
| InChI | InChI=1S/C22H20ClFN2O/c1-25-10-8-17-18-14-16(23)4-5-20(18)26(21(17)9-11-25)12-7-15-3-6-22(27-2)19(24)13-15/h3-6,13-14H,8-11H2,1-2H3 |
| InChIKey | VYIZYSAPKQYRTR-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.87 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|