About 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide
5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide (PubChem CID 46191782) has the molecular formula C20H16ClF2N3O
and a molecular weight of 387.82 g/mol. Its IUPAC name is 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
| PubChem CID | 46191782 |
| Molecular Formula | C20H16ClF2N3O |
| Molecular Weight | 387.82 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide |
| SMILES | Cc1[nH]c2c(F)c(F)ccc2c1CCNC(=O)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C20H16ClF2N3O/c1-10-13(14-3-4-15(22)18(23)19(14)25-10)6-7-24-20(27)17-9-11-8-12(21)2-5-16(11)26-17/h2-5,8-9,25-26H,6-7H2,1H3,(H,24,27) |
| InChIKey | VGGUUWHWVRXVPH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide?
The IUPAC name of 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide (CID 46191782) is 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide.
What is the SMILES notation for 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide?
The canonical SMILES for 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide is Cc1[nH]c2c(F)c(F)ccc2c1CCNC(=O)c1cc2cc(Cl)ccc2[nH]1.
What is the InChIKey of 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide?
The InChIKey is VGGUUWHWVRXVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClF2N3O/c1-10-13(14-3-4-15(22)18(23)19(14)25-10)6-7-24-20(27)17-9-11-8-12(21)2-5-16(11)26-17/h2-5,8-9,25-26H,6-7H2,1H3,(H,24,27).
What are the key properties of 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide?
5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide has a molecular weight of 387.82 g/mol, XLogP of 4.86, 4 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[2-(6,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-1H-indole-2-carboxamide is sourced from PubChem (CID 46191782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).