C19H36O3Si — CID 46191799
(1R,3R,4S,6S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-hydroxypropyl)tricyclo[4.3.0.01,3]nonan-7-ol (PubChem CID 46191799) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (1R,3R,4S,6S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-hydroxypropyl)tricyclo[4.3.0.01,3]nonan-7-ol.
| Compound Name | (1R,3R,4S,6S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-hydroxypropyl)tricyclo[4.3.0.01,3]nonan-7-ol |
|---|---|
| PubChem CID | 46191799 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1R,3R,4S,6S,7S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(3-hydroxypropyl)tricyclo[4.3.0.01,3]nonan-7-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@]12C[C@@]13CC[C@H](O)[C@H]3C[C@@H]2CCCO |
| InChI | InChI=1S/C19H36O3Si/c1-17(2,3)23(4,5)22-13-19-12-18(19)9-8-16(21)15(18)11-14(19)7-6-10-20/h14-16,20-21H,6-13H2,1-5H3/t14-,15+,16-,18+,19+/m0/s1 |
| InChIKey | ICTPCWCQCBBVOB-HRAJDOBDSA-N |
| XLogP | 3.95 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|