C14H18O — CID 46191803
(1S,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carbaldehyde (PubChem CID 46191803) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1S,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carbaldehyde.
| Compound Name | (1S,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carbaldehyde |
|---|---|
| PubChem CID | 46191803 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1S,2R,4R,7R,12R)-8-methylidenetetracyclo[5.3.2.02,4.04,12]dodecane-2-carbaldehyde |
| SMILES | C=C1CC[C@H]2C[C@@H]3[C@H]1CC[C@@]31C[C@@]21C=O |
| InChI | InChI=1S/C14H18O/c1-9-2-3-10-6-12-11(9)4-5-13(12)7-14(10,13)8-15/h8,10-12H,1-7H2/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | OZAWSMCBAGYZJR-ODXJTPSBSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|