C38H34Br2O4 — CID 46192040
[3,6-bis(4-bromophenyl)-5-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,4-dioxan-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone (PubChem CID 46192040) has the molecular formula C38H34Br2O4 and a molecular weight of 714.49 g/mol. Its IUPAC name is [3,6-bis(4-bromophenyl)-5-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,4-dioxan-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone.
| Compound Name | [3,6-bis(4-bromophenyl)-5-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,4-dioxan-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
|---|---|
| PubChem CID | 46192040 |
| Molecular Formula | C38H34Br2O4 |
| Molecular Weight | 714.49 g/mol |
| Exact Mass | 712.08 |
| IUPAC Name | [3,6-bis(4-bromophenyl)-5-(5,6,7,8-tetrahydronaphthalene-2-carbonyl)-1,4-dioxan-2-yl]-(5,6,7,8-tetrahydronaphthalen-2-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)CCCC2)C1OC(c2ccc(Br)cc2)C(C(=O)c2ccc3c(c2)CCCC3)OC1c1ccc(Br)cc1 |
| InChI | InChI=1S/C38H34Br2O4/c39-31-17-13-25(14-18-31)35-37(33(41)29-11-9-23-5-1-3-7-27(23)21-29)43-36(26-15-19-32(40)20-16-26)38(44-35)34(42)30-12-10-24-6-2-4-8-28(24)22-30/h9-22,35-38H,1-8H2 |
| InChIKey | NGNZTKKVMDYOFQ-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.49 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |