C19H20N2O — CID 46192062
(2S,5S)-5-benzyl-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one (PubChem CID 46192062) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is (2S,5S)-5-benzyl-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one.
| Compound Name | (2S,5S)-5-benzyl-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one |
|---|---|
| PubChem CID | 46192062 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | (2S,5S)-5-benzyl-3-methyl-2-(1-phenylethenyl)imidazolidin-4-one |
| SMILES | C=C(c1ccccc1)[C@H]1N[C@@H](Cc2ccccc2)C(=O)N1C |
| InChI | InChI=1S/C19H20N2O/c1-14(16-11-7-4-8-12-16)18-20-17(19(22)21(18)2)13-15-9-5-3-6-10-15/h3-12,17-18,20H,1,13H2,2H3/t17-,18-/m0/s1 |
| InChIKey | RZKGXCLTDXQUJV-ROUUACIJSA-N |
| XLogP | 2.70 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |