C20H36O10Si — CID 46192139
[(2R,3R,4R,5R)-3,4,5-triacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyhexan-2-yl] acetate (PubChem CID 46192139) has the molecular formula C20H36O10Si and a molecular weight of 464.58 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4,5-triacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyhexan-2-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4,5-triacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyhexan-2-yl] acetate |
|---|---|
| PubChem CID | 46192139 |
| Molecular Formula | C20H36O10Si |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4,5-triacetyloxy-6-[tert-butyl(dimethyl)silyl]oxy-1-hydroxyhexan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H]([C@H](OC(C)=O)[C@@H](CO[Si](C)(C)C(C)(C)C)OC(C)=O)[C@@H](CO)OC(C)=O |
| InChI | InChI=1S/C20H36O10Si/c1-12(22)27-16(10-21)18(29-14(3)24)19(30-15(4)25)17(28-13(2)23)11-26-31(8,9)20(5,6)7/h16-19,21H,10-11H2,1-9H3/t16-,17-,18-,19-/m1/s1 |
| InChIKey | DKBSUKYWSUUTCB-NCXUSEDFSA-N |
| XLogP | 1.73 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|