C14H18O — CID 46192244
(1R,2S,3S,4S,7R,8S)-3,6,6-trimethyltetracyclo[6.3.0.02,4.03,7]undec-10-en-5-one (PubChem CID 46192244) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (1R,2S,3S,4S,7R,8S)-3,6,6-trimethyltetracyclo[6.3.0.02,4.03,7]undec-10-en-5-one.
| Compound Name | (1R,2S,3S,4S,7R,8S)-3,6,6-trimethyltetracyclo[6.3.0.02,4.03,7]undec-10-en-5-one |
|---|---|
| PubChem CID | 46192244 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (1R,2S,3S,4S,7R,8S)-3,6,6-trimethyltetracyclo[6.3.0.02,4.03,7]undec-10-en-5-one |
| SMILES | CC1(C)C(=O)[C@H]2[C@@H]3[C@@H]4C=CC[C@@H]4[C@@H]1[C@]32C |
| InChI | InChI=1S/C14H18O/c1-13(2)11-8-6-4-5-7(8)9-10(12(13)15)14(9,11)3/h4-5,7-11H,6H2,1-3H3/t7-,8+,9+,10-,11+,14-/m1/s1 |
| InChIKey | OIBSFAKSTIXSSS-GPRJABABSA-N |
| XLogP | 2.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|