About ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate
ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate (PubChem CID 46192590) has the molecular formula C27H29N3O3
and a molecular weight of 443.55 g/mol. Its IUPAC name is ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate |
| PubChem CID | 46192590 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate |
| SMILES | CCCCn1c2ccccc2c2cc(C(=O)N[C@@H](Cc3ccccc3)C(=O)OCC)ncc21 |
| InChI | InChI=1S/C27H29N3O3/c1-3-5-15-30-24-14-10-9-13-20(24)21-17-22(28-18-25(21)30)26(31)29-23(27(32)33-4-2)16-19-11-7-6-8-12-19/h6-14,17-18,23H,3-5,15-16H2,1-2H3,(H,29,31)/t23-/m0/s1 |
| InChIKey | FJXSJGAJHFUTTL-QHCPKHFHSA-N |
| XLogP | 4.89 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate?
The IUPAC name of ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate (CID 46192590) is ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate.
What is the SMILES notation for ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate?
The canonical SMILES for ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate is CCCCn1c2ccccc2c2cc(C(=O)N[C@@H](Cc3ccccc3)C(=O)OCC)ncc21.
What is the InChIKey of ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate?
The InChIKey is FJXSJGAJHFUTTL-QHCPKHFHSA-N. The full InChI is InChI=1S/C27H29N3O3/c1-3-5-15-30-24-14-10-9-13-20(24)21-17-22(28-18-25(21)30)26(31)29-23(27(32)33-4-2)16-19-11-7-6-8-12-19/h6-14,17-18,23H,3-5,15-16H2,1-2H3,(H,29,31)/t23-/m0/s1.
What are the key properties of ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate?
ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate has a molecular weight of 443.55 g/mol, XLogP of 4.89, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-2-[(9-butylpyrido[3,4-b]indole-3-carbonyl)amino]-3-phenylpropanoate is sourced from PubChem (CID 46192590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).