C10H14O2 — CID 46192805
2,7-dimethylocta-1,7-dien-4-yne-3,6-diol (PubChem CID 46192805) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is 2,7-dimethylocta-1,7-dien-4-yne-3,6-diol.
| Compound Name | 2,7-dimethylocta-1,7-dien-4-yne-3,6-diol |
|---|---|
| PubChem CID | 46192805 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | 2,7-dimethylocta-1,7-dien-4-yne-3,6-diol |
| SMILES | C=C(C)C(O)C#CC(O)C(=C)C |
| InChI | InChI=1S/C10H14O2/c1-7(2)9(11)5-6-10(12)8(3)4/h9-12H,1,3H2,2,4H3 |
| InChIKey | VJARRRZREKPWSO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|