About 1H-pyrazolo[3,4-b]pyridin-5-amine
1H-pyrazolo[3,4-b]pyridin-5-amine (PubChem CID 46192922) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1H-pyrazolo[3,4-b]pyridin-5-amine.
Molecular Properties
| Compound Name | 1H-pyrazolo[3,4-b]pyridin-5-amine |
| PubChem CID | 46192922 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1H-pyrazolo[3,4-b]pyridin-5-amine |
| SMILES | Nc1cnc2[nH]ncc2c1 |
| InChI | InChI=1S/C6H6N4/c7-5-1-4-2-9-10-6(4)8-3-5/h1-3H,7H2,(H,8,9,10) |
| InChIKey | OVICNYHPCJRQEY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazolo[3,4-b]pyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazolo[3,4-b]pyridin-5-amine?
The IUPAC name of 1H-pyrazolo[3,4-b]pyridin-5-amine (CID 46192922) is 1H-pyrazolo[3,4-b]pyridin-5-amine.
What is the SMILES notation for 1H-pyrazolo[3,4-b]pyridin-5-amine?
The canonical SMILES for 1H-pyrazolo[3,4-b]pyridin-5-amine is Nc1cnc2[nH]ncc2c1.
What is the InChIKey of 1H-pyrazolo[3,4-b]pyridin-5-amine?
The InChIKey is OVICNYHPCJRQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c7-5-1-4-2-9-10-6(4)8-3-5/h1-3H,7H2,(H,8,9,10).
What are the key properties of 1H-pyrazolo[3,4-b]pyridin-5-amine?
1H-pyrazolo[3,4-b]pyridin-5-amine has a molecular weight of 134.14 g/mol, XLogP of 0.54, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazolo[3,4-b]pyridin-5-amine is sourced from PubChem (CID 46192922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).