C18H14BrN5S2 — CID 46193014
3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 46193014) has the molecular formula C18H14BrN5S2 and a molecular weight of 444.38 g/mol. Its IUPAC name is 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 46193014 |
| Molecular Formula | C18H14BrN5S2 |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 3-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]amino]-4-(2-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccccc1-n1c(Nc2nc(-c3ccc(Br)cc3)cs2)n[nH]c1=S |
| InChI | InChI=1S/C18H14BrN5S2/c1-11-4-2-3-5-15(11)24-16(22-23-18(24)25)21-17-20-14(10-26-17)12-6-8-13(19)9-7-12/h2-10H,1H3,(H,23,25)(H,20,21,22) |
| InChIKey | KEDAOPIBANYTQB-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|