C13H23ClN4O5 — CID 46193020
(2S,3S)-2-amino-N-[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-3-methylpentanamide;hydrochloride (PubChem CID 46193020) has the molecular formula C13H23ClN4O5 and a molecular weight of 350.80 g/mol. Its IUPAC name is (2S,3S)-2-amino-N-[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-3-methylpentanamide;hydrochloride.
| Compound Name | (2S,3S)-2-amino-N-[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-3-methylpentanamide;hydrochloride |
|---|---|
| PubChem CID | 46193020 |
| Molecular Formula | C13H23ClN4O5 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (2S,3S)-2-amino-N-[(3S)-1-[2-(hydroxyamino)-2-oxoethyl]-2,6-dioxopiperidin-3-yl]-3-methylpentanamide;hydrochloride |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@H]1CCC(=O)N(CC(=O)NO)C1=O.Cl |
| InChI | InChI=1S/C13H22N4O5.ClH/c1-3-7(2)11(14)12(20)15-8-4-5-10(19)17(13(8)21)6-9(18)16-22;/h7-8,11,22H,3-6,14H2,1-2H3,(H,15,20)(H,16,18);1H/t7-,8-,11-;/m0./s1 |
| InChIKey | GCQLJBNZHASCMY-AEXHUXLESA-N |
| XLogP | -1.08 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|