C27H54O5Si2 — CID 46193056
(Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxoundec-9-enoic acid (PubChem CID 46193056) has the molecular formula C27H54O5Si2 and a molecular weight of 514.90 g/mol. Its IUPAC name is (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxoundec-9-enoic acid.
| Compound Name | (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxoundec-9-enoic acid |
|---|---|
| PubChem CID | 46193056 |
| Molecular Formula | C27H54O5Si2 |
| Molecular Weight | 514.90 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | (Z,3S,6R,7S,8S)-3,7-bis[[tert-butyl(dimethyl)silyl]oxy]-4,4,6,8-tetramethyl-5-oxoundec-9-enoic acid |
| SMILES | C/C=C\[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@H](CC(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O5Si2/c1-16-17-19(2)23(32-34(14,15)26(7,8)9)20(3)24(30)27(10,11)21(18-22(28)29)31-33(12,13)25(4,5)6/h16-17,19-21,23H,18H2,1-15H3,(H,28,29)/b17-16-/t19-,20+,21-,23-/m0/s1 |
| InChIKey | USTNWYIWAFGPPL-OYQKIRMDSA-N |
| XLogP | 7.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.90 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|