C34H62O6Si2 — CID 46193183
(4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione (PubChem CID 46193183) has the molecular formula C34H62O6Si2 and a molecular weight of 623.04 g/mol. Its IUPAC name is (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione.
| Compound Name | (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
|---|---|
| PubChem CID | 46193183 |
| Molecular Formula | C34H62O6Si2 |
| Molecular Weight | 623.04 g/mol |
| Exact Mass | 622.41 |
| IUPAC Name | (4S,7R,8S,9S,10E,13Z,16S)-16-acetyl-4,8-bis[[tert-butyl(dimethyl)silyl]oxy]-5,5,7,9,13-pentamethyl-1-oxacyclohexadeca-10,13-diene-2,6-dione |
| SMILES | CC(=O)[C@@H]1C/C=C(/C)C/C=C/[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)C(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C34H62O6Si2/c1-23-18-17-19-24(2)30(40-42(15,16)33(8,9)10)25(3)31(37)34(11,12)28(39-41(13,14)32(5,6)7)22-29(36)38-27(21-20-23)26(4)35/h17,19-20,24-25,27-28,30H,18,21-22H2,1-16H3/b19-17+,23-20-/t24-,25+,27-,28-,30-/m0/s1 |
| InChIKey | ULEUSNWURHOBCE-MJDZDHPDSA-N |
| XLogP | 8.82 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.04 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|