C18H15N5OS2 — CID 46193273
4-(2-methoxyphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]-1H-1,2,4-triazole-5-thione (PubChem CID 46193273) has the molecular formula C18H15N5OS2 and a molecular weight of 381.49 g/mol. Its IUPAC name is 4-(2-methoxyphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-(2-methoxyphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 46193273 |
| Molecular Formula | C18H15N5OS2 |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | 4-(2-methoxyphenyl)-3-[(4-phenyl-1,3-thiazol-2-yl)amino]-1H-1,2,4-triazole-5-thione |
| SMILES | COc1ccccc1-n1c(Nc2nc(-c3ccccc3)cs2)n[nH]c1=S |
| InChI | InChI=1S/C18H15N5OS2/c1-24-15-10-6-5-9-14(15)23-16(21-22-18(23)25)20-17-19-13(11-26-17)12-7-3-2-4-8-12/h2-11H,1H3,(H,22,25)(H,19,20,21) |
| InChIKey | HUODMFSLGRMSHE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|