C23H36O6 — CID 46193472
methyl 2-[(1S,3R,6R,7R,10E,14S)-7-acetyloxy-6-hydroxy-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoate (PubChem CID 46193472) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl 2-[(1S,3R,6R,7R,10E,14S)-7-acetyloxy-6-hydroxy-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoate.
| Compound Name | methyl 2-[(1S,3R,6R,7R,10E,14S)-7-acetyloxy-6-hydroxy-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 46193472 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | methyl 2-[(1S,3R,6R,7R,10E,14S)-7-acetyloxy-6-hydroxy-6,10,14-trimethyl-15-oxabicyclo[12.1.0]pentadec-10-en-3-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@](C)(O)[C@H](OC(C)=O)CC/C(C)=C/CC[C@]2(C)O[C@H]2C1 |
| InChI | InChI=1S/C23H36O6/c1-15-8-7-12-23(5)20(29-23)14-18(16(2)21(25)27-6)11-13-22(4,26)19(10-9-15)28-17(3)24/h8,18-20,26H,2,7,9-14H2,1,3-6H3/b15-8+/t18-,19-,20+,22-,23+/m1/s1 |
| InChIKey | WIUZTEVKBSGUCK-RWCAJJJKSA-N |
| XLogP | 3.86 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|