C15H18N2OS — CID 46193553
2-[4-(dimethylamino)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol (PubChem CID 46193553) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-[4-(dimethylamino)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol.
| Compound Name | 2-[4-(dimethylamino)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
|---|---|
| PubChem CID | 46193553 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-[4-(dimethylamino)phenyl]-4,5,6,7-tetrahydro-1,3-benzothiazol-7-ol |
| SMILES | CN(C)c1ccc(-c2nc3c(s2)C(O)CCC3)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-17(2)11-8-6-10(7-9-11)15-16-12-4-3-5-13(18)14(12)19-15/h6-9,13,18H,3-5H2,1-2H3 |
| InChIKey | HMANXAFVUFXDNZ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|