C19H16N2O3Se — CID 46193608
methyl 5-(1-benzyl-5-methylselenopheno[3,2-c]pyrazol-3-yl)furan-2-carboxylate (PubChem CID 46193608) has the molecular formula C19H16N2O3Se and a molecular weight of 399.31 g/mol. Its IUPAC name is methyl 5-(1-benzyl-5-methylselenopheno[3,2-c]pyrazol-3-yl)furan-2-carboxylate.
| Compound Name | methyl 5-(1-benzyl-5-methylselenopheno[3,2-c]pyrazol-3-yl)furan-2-carboxylate |
|---|---|
| PubChem CID | 46193608 |
| Molecular Formula | C19H16N2O3Se |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | methyl 5-(1-benzyl-5-methylselenopheno[3,2-c]pyrazol-3-yl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(-c2nn(Cc3ccccc3)c3cc(C)[se]c23)o1 |
| InChI | InChI=1S/C19H16N2O3Se/c1-12-10-14-18(25-12)17(15-8-9-16(24-15)19(22)23-2)20-21(14)11-13-6-4-3-5-7-13/h3-10H,11H2,1-2H3 |
| InChIKey | ZEQRYYWLUDGVIX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|