C20H19FN2O4S — CID 46193662
N-[3-(3-fluorophenyl)-4-methyl-1,3-thiazol-2-ylidene]-3,4,5-trimethoxybenzamide (PubChem CID 46193662) has the molecular formula C20H19FN2O4S and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[3-(3-fluorophenyl)-4-methyl-1,3-thiazol-2-ylidene]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[3-(3-fluorophenyl)-4-methyl-1,3-thiazol-2-ylidene]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46193662 |
| Molecular Formula | C20H19FN2O4S |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | N-[3-(3-fluorophenyl)-4-methyl-1,3-thiazol-2-ylidene]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)/N=c2\scc(C)n2-c2cccc(F)c2)cc(OC)c1OC |
| InChI | InChI=1S/C20H19FN2O4S/c1-12-11-28-20(23(12)15-7-5-6-14(21)10-15)22-19(24)13-8-16(25-2)18(27-4)17(9-13)26-3/h5-11H,1-4H3/b22-20- |
| InChIKey | QDWGYJUTAVQFGL-XDOYNYLZSA-N |
| XLogP | 3.75 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|