C27H35BrN2O5 — CID 46193678
tert-butyl N-[(3aR,5R,6S,6aR)-5-[(benzylamino)methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-N-[(2-bromophenyl)methyl]carbamate (PubChem CID 46193678) has the molecular formula C27H35BrN2O5 and a molecular weight of 547.49 g/mol. Its IUPAC name is tert-butyl N-[(3aR,5R,6S,6aR)-5-[(benzylamino)methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-N-[(2-bromophenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[(3aR,5R,6S,6aR)-5-[(benzylamino)methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-N-[(2-bromophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 46193678 |
| Molecular Formula | C27H35BrN2O5 |
| Molecular Weight | 547.49 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | tert-butyl N-[(3aR,5R,6S,6aR)-5-[(benzylamino)methyl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]-N-[(2-bromophenyl)methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccccc1Br)[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1CNCc1ccccc1 |
| InChI | InChI=1S/C27H35BrN2O5/c1-26(2,3)35-25(31)30(17-19-13-9-10-14-20(19)28)22-21(16-29-15-18-11-7-6-8-12-18)32-24-23(22)33-27(4,5)34-24/h6-14,21-24,29H,15-17H2,1-5H3/t21-,22+,23-,24-/m1/s1 |
| InChIKey | AOTIOIMCQLOORN-UEQSERJNSA-N |
| XLogP | 5.22 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |