About 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one
2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one (PubChem CID 46193990) has the molecular formula C23H28N2O2
and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one.
Molecular Properties
| Compound Name | 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one |
| PubChem CID | 46193990 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one |
| SMILES | CC1(C)C(=O)N(C2CCCCCCC2)N1C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C23H28N2O2/c1-23(2)22(27)24(18-13-6-4-3-5-7-14-18)25(23)21(26)20-16-10-12-17-11-8-9-15-19(17)20/h8-12,15-16,18H,3-7,13-14H2,1-2H3 |
| InChIKey | IXGMUHPALDIBBT-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one?
The IUPAC name of 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one (CID 46193990) is 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one.
What is the SMILES notation for 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one?
The canonical SMILES for 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one is CC1(C)C(=O)N(C2CCCCCCC2)N1C(=O)c1cccc2ccccc12.
What is the InChIKey of 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one?
The InChIKey is IXGMUHPALDIBBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28N2O2/c1-23(2)22(27)24(18-13-6-4-3-5-7-14-18)25(23)21(26)20-16-10-12-17-11-8-9-15-19(17)20/h8-12,15-16,18H,3-7,13-14H2,1-2H3.
What are the key properties of 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one?
2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one has a molecular weight of 364.49 g/mol, XLogP of 4.93, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclooctyl-4,4-dimethyl-1-(naphthalene-1-carbonyl)diazetidin-3-one is sourced from PubChem (CID 46193990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).