C23H31N3O6 — CID 46194083
(E)-but-2-enedioic acid;2-(1-cyclobutylpiperidin-4-yl)oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 46194083) has the molecular formula C23H31N3O6 and a molecular weight of 445.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(1-cyclobutylpiperidin-4-yl)oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one.
| Compound Name | (E)-but-2-enedioic acid;2-(1-cyclobutylpiperidin-4-yl)oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 46194083 |
| Molecular Formula | C23H31N3O6 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.22 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(1-cyclobutylpiperidin-4-yl)oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CCN1CCc2nc(OC3CCN(C4CCC4)CC3)ccc2C1=O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H27N3O2.C4H4O4/c1-2-21-13-10-17-16(19(21)23)6-7-18(20-17)24-15-8-11-22(12-9-15)14-4-3-5-14;5-3(6)1-2-4(7)8/h6-7,14-15H,2-5,8-13H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | LPPSWMQEFDFRBK-WLHGVMLRSA-N |
| XLogP | 2.21 |
| TPSA | 120.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|