C27H37N3O7S — CID 46194229
[(3R,3aS,6aR)-3,5,5-trideuterio-2,3a,4,6a-tetrahydrofuro[2,3-b]furan-3-yl] N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate (PubChem CID 46194229) has the molecular formula C27H37N3O7S and a molecular weight of 550.69 g/mol. Its IUPAC name is [(3R,3aS,6aR)-3,5,5-trideuterio-2,3a,4,6a-tetrahydrofuro[2,3-b]furan-3-yl] N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate.
| Compound Name | [(3R,3aS,6aR)-3,5,5-trideuterio-2,3a,4,6a-tetrahydrofuro[2,3-b]furan-3-yl] N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 46194229 |
| Molecular Formula | C27H37N3O7S |
| Molecular Weight | 550.69 g/mol |
| Exact Mass | 550.25 |
| IUPAC Name | [(3R,3aS,6aR)-3,5,5-trideuterio-2,3a,4,6a-tetrahydrofuro[2,3-b]furan-3-yl] N-[(2S,3R)-4-[(4-aminophenyl)sulfonyl-(2-methylpropyl)amino]-3-hydroxy-1-phenylbutan-2-yl]carbamate |
| SMILES | [2H]C1([2H])C[C@@H]2[C@@H](OC[C@]2([2H])OC(=O)N[C@@H](Cc2ccccc2)[C@H](O)CN(CC(C)C)S(=O)(=O)c2ccc(N)cc2)O1 |
| InChI | InChI=1S/C27H37N3O7S/c1-18(2)15-30(38(33,34)21-10-8-20(28)9-11-21)16-24(31)23(14-19-6-4-3-5-7-19)29-27(32)37-25-17-36-26-22(25)12-13-35-26/h3-11,18,22-26,31H,12-17,28H2,1-2H3,(H,29,32)/t22-,23-,24+,25-,26+/m0/s1/i13D2,25D |
| InChIKey | CJBJHOAVZSMMDJ-QBLGCMHWSA-N |
| XLogP | 2.38 |
| TPSA | 140.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.69 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|