About 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one
2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one (PubChem CID 46194476) has the molecular formula C19H27N3O2
and a molecular weight of 329.44 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one.
Molecular Properties
| Compound Name | 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one |
| PubChem CID | 46194476 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one |
| SMILES | CCN1CCc2nc(OC3CCN(CC4CC4)CC3)ccc2C1=O |
| InChI | InChI=1S/C19H27N3O2/c1-2-22-12-9-17-16(19(22)23)5-6-18(20-17)24-15-7-10-21(11-8-15)13-14-3-4-14/h5-6,14-15H,2-4,7-13H2,1H3 |
| InChIKey | TYFASFRAYQZXEZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one?
The IUPAC name of 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one (CID 46194476) is 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one.
What is the SMILES notation for 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one?
The canonical SMILES for 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one is CCN1CCc2nc(OC3CCN(CC4CC4)CC3)ccc2C1=O.
What is the InChIKey of 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one?
The InChIKey is TYFASFRAYQZXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27N3O2/c1-2-22-12-9-17-16(19(22)23)5-6-18(20-17)24-15-7-10-21(11-8-15)13-14-3-4-14/h5-6,14-15H,2-4,7-13H2,1H3.
What are the key properties of 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one?
2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one has a molecular weight of 329.44 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(cyclopropylmethyl)piperidin-4-yl]oxy-6-ethyl-7,8-dihydro-1,6-naphthyridin-5-one is sourced from PubChem (CID 46194476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).