C24H44N2O5Y+3 — CID 46194500
4,11,17,24,29-pentaoxa-1,14-diazatetracyclo[12.12.5.05,10.018,23]hentriacontane;yttrium(3+) (PubChem CID 46194500) has the molecular formula C24H44N2O5Y+3 and a molecular weight of 529.53 g/mol. Its IUPAC name is 4,11,17,24,29-pentaoxa-1,14-diazatetracyclo[12.12.5.05,10.018,23]hentriacontane;yttrium(3+).
| Compound Name | 4,11,17,24,29-pentaoxa-1,14-diazatetracyclo[12.12.5.05,10.018,23]hentriacontane;yttrium(3+) |
|---|---|
| PubChem CID | 46194500 |
| Molecular Formula | C24H44N2O5Y+3 |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | 4,11,17,24,29-pentaoxa-1,14-diazatetracyclo[12.12.5.05,10.018,23]hentriacontane;yttrium(3+) |
| SMILES | C1CCC2OCCN3CCOCCN(CCOC2C1)CCOC1CCCCC1OCC3.[Y+3] |
| InChI | InChI=1S/C24H44N2O5.Y/c1-2-6-22-21(5-1)28-17-11-25-9-15-27-16-10-26(12-18-29-22)14-20-31-24-8-4-3-7-23(24)30-19-13-25;/h21-24H,1-20H2;/q;+3 |
| InChIKey | ZZJYPBWSCITHMZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|