About Tempone 15N,D16
Tempone 15N,D16 (PubChem CID 46195008) has the molecular formula C9H16NO2
and a molecular weight of 187.32 g/mol.
Molecular Properties
| Compound Name | Tempone 15N,D16 |
| PubChem CID | 46195008 |
| Molecular Formula | C9H16NO2 |
| Molecular Weight | 187.32 g/mol |
| Exact Mass | 187.22 |
| IUPAC Name | — |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])[15N]([O])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)C1([2H])[2H] |
| InChI | InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,10+1 |
| InChIKey | WSGDRFHJFJRSFY-ZDYDSYIGSA-N |
| XLogP | 1.55 |
| TPSA | 40.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Tempone 15N,D16 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tempone 15N,D16?
The IUPAC name of Tempone 15N,D16 (CID 46195008) is not available.
What is the SMILES notation for Tempone 15N,D16?
The canonical SMILES for Tempone 15N,D16 is [2H]C([2H])([2H])C1(C([2H])([2H])[2H])[15N]([O])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C(=O)C1([2H])[2H].
What is the InChIKey of Tempone 15N,D16?
The InChIKey is WSGDRFHJFJRSFY-ZDYDSYIGSA-N. The full InChI is InChI=1S/C9H16NO2/c1-8(2)5-7(11)6-9(3,4)10(8)12/h5-6H2,1-4H3/i1D3,2D3,3D3,4D3,5D2,6D2,10+1.
What are the key properties of Tempone 15N,D16?
Tempone 15N,D16 has a molecular weight of 187.32 g/mol, XLogP of 1.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Tempone 15N,D16 is sourced from PubChem (CID 46195008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).