About 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one
5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one (PubChem CID 46195373) has the molecular formula C19H20O6
and a molecular weight of 344.36 g/mol. Its IUPAC name is 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one |
| PubChem CID | 46195373 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one |
| SMILES | COc1ccc(CC2COc3c(OC)c(O)c(C)c(O)c3C2=O)cc1 |
| InChI | InChI=1S/C19H20O6/c1-10-15(20)14-17(22)12(8-11-4-6-13(23-2)7-5-11)9-25-18(14)19(24-3)16(10)21/h4-7,12,20-21H,8-9H2,1-3H3 |
| InChIKey | RPWMHBQEUCKBPH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one?
The IUPAC name of 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one (CID 46195373) is 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one.
What is the SMILES notation for 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one?
The canonical SMILES for 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one is COc1ccc(CC2COc3c(OC)c(O)c(C)c(O)c3C2=O)cc1.
What is the InChIKey of 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one?
The InChIKey is RPWMHBQEUCKBPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O6/c1-10-15(20)14-17(22)12(8-11-4-6-13(23-2)7-5-11)9-25-18(14)19(24-3)16(10)21/h4-7,12,20-21H,8-9H2,1-3H3.
What are the key properties of 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one?
5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one has a molecular weight of 344.36 g/mol, XLogP of 2.86, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydroxy-8-methoxy-3-[(4-methoxyphenyl)methyl]-6-methyl-2,3-dihydrochromen-4-one is sourced from PubChem (CID 46195373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).