C26H34N4O5 — CID 46195467
2-amino-2-[[4-[5-(3,4-dipropoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol (PubChem CID 46195467) has the molecular formula C26H34N4O5 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-amino-2-[[4-[5-(3,4-dipropoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[[4-[5-(3,4-dipropoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46195467 |
| Molecular Formula | C26H34N4O5 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | 2-amino-2-[[4-[5-(3,4-dipropoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
| SMILES | CCCOc1ccc(-c2nc(-c3cccc4c3CCN4CC(N)(CO)CO)no2)cc1OCCC |
| InChI | InChI=1S/C26H34N4O5/c1-3-12-33-22-9-8-18(14-23(22)34-13-4-2)25-28-24(29-35-25)20-6-5-7-21-19(20)10-11-30(21)15-26(27,16-31)17-32/h5-9,14,31-32H,3-4,10-13,15-17,27H2,1-2H3 |
| InChIKey | NBOTXMJUPYPBQH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |