C25H31ClN4O4 — CID 46195601
2-amino-2-[[5-[5-(3-chloro-4-pentoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol (PubChem CID 46195601) has the molecular formula C25H31ClN4O4 and a molecular weight of 487.00 g/mol. Its IUPAC name is 2-amino-2-[[5-[5-(3-chloro-4-pentoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[[5-[5-(3-chloro-4-pentoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46195601 |
| Molecular Formula | C25H31ClN4O4 |
| Molecular Weight | 487.00 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 2-amino-2-[[5-[5-(3-chloro-4-pentoxyphenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
| SMILES | CCCCCOc1ccc(-c2nc(-c3ccc4c(c3)CCN4CC(N)(CO)CO)no2)cc1Cl |
| InChI | InChI=1S/C25H31ClN4O4/c1-2-3-4-11-33-22-8-6-19(13-20(22)26)24-28-23(29-34-24)18-5-7-21-17(12-18)9-10-30(21)14-25(27,15-31)16-32/h5-8,12-13,31-32H,2-4,9-11,14-16,27H2,1H3 |
| InChIKey | ZVUQENDTVQTNSE-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.00 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|