C24H29ClN4O4 — CID 46195602
2-amino-2-[[5-[5-(4-butoxy-3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol (PubChem CID 46195602) has the molecular formula C24H29ClN4O4 and a molecular weight of 472.97 g/mol. Its IUPAC name is 2-amino-2-[[5-[5-(4-butoxy-3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[[5-[5-(4-butoxy-3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 46195602 |
| Molecular Formula | C24H29ClN4O4 |
| Molecular Weight | 472.97 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-amino-2-[[5-[5-(4-butoxy-3-chlorophenyl)-1,2,4-oxadiazol-3-yl]-2,3-dihydroindol-1-yl]methyl]propane-1,3-diol |
| SMILES | CCCCOc1ccc(-c2nc(-c3ccc4c(c3)CCN4CC(N)(CO)CO)no2)cc1Cl |
| InChI | InChI=1S/C24H29ClN4O4/c1-2-3-10-32-21-7-5-18(12-19(21)25)23-27-22(28-33-23)17-4-6-20-16(11-17)8-9-29(20)13-24(26,14-30)15-31/h4-7,11-12,30-31H,2-3,8-10,13-15,26H2,1H3 |
| InChIKey | GLNFOJKGKLUMRG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.97 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|