About 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine
6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine (PubChem CID 46196307) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine |
| PubChem CID | 46196307 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine |
| SMILES | c1cc(CN2CCCCC2)cc(-c2ccc3nccnc3n2)c1 |
| InChI | InChI=1S/C19H20N4/c1-2-11-23(12-3-1)14-15-5-4-6-16(13-15)17-7-8-18-19(22-17)21-10-9-20-18/h4-10,13H,1-3,11-12,14H2 |
| InChIKey | PFKBSICTHQCUFK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine?
The IUPAC name of 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine (CID 46196307) is 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine.
What is the SMILES notation for 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine?
The canonical SMILES for 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine is c1cc(CN2CCCCC2)cc(-c2ccc3nccnc3n2)c1.
What is the InChIKey of 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine?
The InChIKey is PFKBSICTHQCUFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-2-11-23(12-3-1)14-15-5-4-6-16(13-15)17-7-8-18-19(22-17)21-10-9-20-18/h4-10,13H,1-3,11-12,14H2.
What are the key properties of 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine?
6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine has a molecular weight of 304.40 g/mol, XLogP of 3.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(piperidin-1-ylmethyl)phenyl]pyrido[2,3-b]pyrazine is sourced from PubChem (CID 46196307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).