C17H18F2S2Si — CID 46196726
[(E)-1,2-bis[(4-fluorophenyl)sulfanyl]ethenyl]-trimethylsilane (PubChem CID 46196726) has the molecular formula C17H18F2S2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is [(E)-1,2-bis[(4-fluorophenyl)sulfanyl]ethenyl]-trimethylsilane.
| Compound Name | [(E)-1,2-bis[(4-fluorophenyl)sulfanyl]ethenyl]-trimethylsilane |
|---|---|
| PubChem CID | 46196726 |
| Molecular Formula | C17H18F2S2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [(E)-1,2-bis[(4-fluorophenyl)sulfanyl]ethenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)/C(=C\Sc1ccc(F)cc1)Sc1ccc(F)cc1 |
| InChI | InChI=1S/C17H18F2S2Si/c1-22(2,3)17(21-16-10-6-14(19)7-11-16)12-20-15-8-4-13(18)5-9-15/h4-12H,1-3H3/b17-12- |
| InChIKey | ARFHNFRNSLTJDP-ATVHPVEESA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|