About [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride
[1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride (PubChem CID 46196785) has the molecular formula C24H30ClNO2
and a molecular weight of 399.96 g/mol. Its IUPAC name is [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride.
Molecular Properties
| Compound Name | [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride |
| PubChem CID | 46196785 |
| Molecular Formula | C24H30ClNO2 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride |
| SMILES | Cl.O=C(c1ccccc1)C1(c2ccccc2)CCN([C@@H]2CCCC[C@H]2O)CC1 |
| InChI | InChI=1S/C24H29NO2.ClH/c26-22-14-8-7-13-21(22)25-17-15-24(16-18-25,20-11-5-2-6-12-20)23(27)19-9-3-1-4-10-19;/h1-6,9-12,21-22,26H,7-8,13-18H2;1H/t21-,22-;/m1./s1 |
| InChIKey | IUDIOUAOBWWKLA-HLUKFBSCSA-N |
| XLogP | 4.63 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride?
The IUPAC name of [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride (CID 46196785) is [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride.
What is the SMILES notation for [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride?
The canonical SMILES for [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride is Cl.O=C(c1ccccc1)C1(c2ccccc2)CCN([C@@H]2CCCC[C@H]2O)CC1.
What is the InChIKey of [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride?
The InChIKey is IUDIOUAOBWWKLA-HLUKFBSCSA-N. The full InChI is InChI=1S/C24H29NO2.ClH/c26-22-14-8-7-13-21(22)25-17-15-24(16-18-25,20-11-5-2-6-12-20)23(27)19-9-3-1-4-10-19;/h1-6,9-12,21-22,26H,7-8,13-18H2;1H/t21-,22-;/m1./s1.
What are the key properties of [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride?
[1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride has a molecular weight of 399.96 g/mol, XLogP of 4.63, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1R,2R)-2-hydroxycyclohexyl]-4-phenylpiperidin-4-yl]-phenylmethanone;hydrochloride is sourced from PubChem (CID 46196785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).