C17H15N3O — CID 46196886
(3E)-3-(dimethylaminomethylidene)-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-one (PubChem CID 46196886) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is (3E)-3-(dimethylaminomethylidene)-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-one.
| Compound Name | (3E)-3-(dimethylaminomethylidene)-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-one |
|---|---|
| PubChem CID | 46196886 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | (3E)-3-(dimethylaminomethylidene)-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-4-one |
| SMILES | CN(C)/C=C1\Cn2c3ccccc3c3ccnc(c32)C1=O |
| InChI | InChI=1S/C17H15N3O/c1-19(2)9-11-10-20-14-6-4-3-5-12(14)13-7-8-18-15(16(13)20)17(11)21/h3-9H,10H2,1-2H3/b11-9+ |
| InChIKey | SGHMNTRGTPKYJV-PKNBQFBNSA-N |
| XLogP | 2.83 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|