C18H14N6O3 — CID 46196973
8-amino-5-(4-methylphenyl)-2,4,6-trioxo-1,5,9,10-tetrahydropyrimido[4,5-b][1,8]naphthyridine-7-carbonitrile (PubChem CID 46196973) has the molecular formula C18H14N6O3 and a molecular weight of 362.35 g/mol. Its IUPAC name is 8-amino-5-(4-methylphenyl)-2,4,6-trioxo-1,5,9,10-tetrahydropyrimido[4,5-b][1,8]naphthyridine-7-carbonitrile.
| Compound Name | 8-amino-5-(4-methylphenyl)-2,4,6-trioxo-1,5,9,10-tetrahydropyrimido[4,5-b][1,8]naphthyridine-7-carbonitrile |
|---|---|
| PubChem CID | 46196973 |
| Molecular Formula | C18H14N6O3 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | 8-amino-5-(4-methylphenyl)-2,4,6-trioxo-1,5,9,10-tetrahydropyrimido[4,5-b][1,8]naphthyridine-7-carbonitrile |
| SMILES | Cc1ccc(C2c3c([nH]c(=O)[nH]c3=O)Nc3[nH]c(N)c(C#N)c(=O)c32)cc1 |
| InChI | InChI=1S/C18H14N6O3/c1-7-2-4-8(5-3-7)10-11-13(25)9(6-19)14(20)21-15(11)22-16-12(10)17(26)24-18(27)23-16/h2-5,10H,1H3,(H6,20,21,22,23,24,25,26,27) |
| InChIKey | LNAQXAVPTIZEDP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |