C20H38O6Si — CID 46197054
ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-2-enoate (PubChem CID 46197054) has the molecular formula C20H38O6Si and a molecular weight of 402.60 g/mol. Its IUPAC name is ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-2-enoate.
| Compound Name | ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-2-enoate |
|---|---|
| PubChem CID | 46197054 |
| Molecular Formula | C20H38O6Si |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | ethyl (E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-6-[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]hex-2-enoate |
| SMILES | CCOC(=O)/C=C/CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1CO |
| InChI | InChI=1S/C20H38O6Si/c1-9-23-17(22)13-11-10-12-15(26-27(7,8)19(2,3)4)18-16(14-21)24-20(5,6)25-18/h11,13,15-16,18,21H,9-10,12,14H2,1-8H3/b13-11+/t15-,16+,18+/m0/s1 |
| InChIKey | QBRJNZCJHQOQCM-VFULBBGFSA-N |
| XLogP | 3.79 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|