C20H38O4Si — CID 46197056
(2E,4E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-2-methylundeca-2,4,10-trien-1-ol (PubChem CID 46197056) has the molecular formula C20H38O4Si and a molecular weight of 370.61 g/mol. Its IUPAC name is (2E,4E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-2-methylundeca-2,4,10-trien-1-ol.
| Compound Name | (2E,4E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-2-methylundeca-2,4,10-trien-1-ol |
|---|---|
| PubChem CID | 46197056 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (2E,4E,8S,9S)-8-[tert-butyl(dimethyl)silyl]oxy-9-(methoxymethoxy)-2-methylundeca-2,4,10-trien-1-ol |
| SMILES | C=C[C@H](OCOC)[C@H](CC/C=C/C=C(\C)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O4Si/c1-9-18(23-16-22-6)19(24-25(7,8)20(3,4)5)14-12-10-11-13-17(2)15-21/h9-11,13,18-19,21H,1,12,14-16H2,2-8H3/b11-10+,17-13+/t18-,19-/m0/s1 |
| InChIKey | SAKWFEWDOBDSBS-DPBRMZRISA-N |
| XLogP | 4.83 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|