C23H26N2O5 — CID 46197270
ethyl (1R,3aS,4R,5S,9bR)-4-ethyl-5-(nitromethyl)-3-phenyl-3a,4,5,9b-tetrahydro-1H-benzo[e][2,1]benzoxazole-1-carboxylate (PubChem CID 46197270) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is ethyl (1R,3aS,4R,5S,9bR)-4-ethyl-5-(nitromethyl)-3-phenyl-3a,4,5,9b-tetrahydro-1H-benzo[e][2,1]benzoxazole-1-carboxylate.
| Compound Name | ethyl (1R,3aS,4R,5S,9bR)-4-ethyl-5-(nitromethyl)-3-phenyl-3a,4,5,9b-tetrahydro-1H-benzo[e][2,1]benzoxazole-1-carboxylate |
|---|---|
| PubChem CID | 46197270 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | ethyl (1R,3aS,4R,5S,9bR)-4-ethyl-5-(nitromethyl)-3-phenyl-3a,4,5,9b-tetrahydro-1H-benzo[e][2,1]benzoxazole-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1ON(c2ccccc2)[C@H]2[C@H](CC)[C@H](C[N+](=O)[O-])c3ccccc3[C@H]21 |
| InChI | InChI=1S/C23H26N2O5/c1-3-16-19(14-24(27)28)17-12-8-9-13-18(17)20-21(16)25(15-10-6-5-7-11-15)30-22(20)23(26)29-4-2/h5-13,16,19-22H,3-4,14H2,1-2H3/t16-,19+,20-,21+,22-/m1/s1 |
| InChIKey | VCGDAWDJSSNSJO-DENWASCKSA-N |
| XLogP | 3.92 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|