About [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene
[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene (PubChem CID 46197430) has the molecular formula C23H17N5S
and a molecular weight of 395.49 g/mol. Its IUPAC name is [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene.
Molecular Properties
| Compound Name | [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene |
| PubChem CID | 46197430 |
| Molecular Formula | C23H17N5S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene |
| SMILES | Cc1nc(-c2ccccc2)sc1-c1nc2ccccn2c1/N=N/c1ccccc1 |
| InChI | InChI=1S/C23H17N5S/c1-16-21(29-23(24-16)17-10-4-2-5-11-17)20-22(27-26-18-12-6-3-7-13-18)28-15-9-8-14-19(28)25-20/h2-15H,1H3/b27-26+ |
| InChIKey | RKZBFLFSLICNDB-CYYJNZCTSA-N |
| XLogP | 6.85 |
| TPSA | 54.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene?
The IUPAC name of [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene (CID 46197430) is [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene.
What is the SMILES notation for [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene?
The canonical SMILES for [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene is Cc1nc(-c2ccccc2)sc1-c1nc2ccccn2c1/N=N/c1ccccc1.
What is the InChIKey of [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene?
The InChIKey is RKZBFLFSLICNDB-CYYJNZCTSA-N. The full InChI is InChI=1S/C23H17N5S/c1-16-21(29-23(24-16)17-10-4-2-5-11-17)20-22(27-26-18-12-6-3-7-13-18)28-15-9-8-14-19(28)25-20/h2-15H,1H3/b27-26+.
What are the key properties of [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene?
[2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene has a molecular weight of 395.49 g/mol, XLogP of 6.85, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-methyl-2-phenyl-1,3-thiazol-5-yl)imidazo[1,2-a]pyridin-3-yl]-phenyldiazene is sourced from PubChem (CID 46197430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).