C21H28N2O11S2 — CID 46197458
[(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxan-2-yl]methyl acetate (PubChem CID 46197458) has the molecular formula C21H28N2O11S2 and a molecular weight of 548.59 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 46197458 |
| Molecular Formula | C21H28N2O11S2 |
| Molecular Weight | 548.59 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [(2R,3R,4S,5R,6S)-3,4,5-triacetyloxy-6-[(4-sulfamoylphenyl)methylamino]sulfanyloxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SNCc2ccc(S(N)(=O)=O)cc2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H28N2O11S2/c1-11(24)30-10-17-18(31-12(2)25)19(32-13(3)26)20(33-14(4)27)21(34-17)35-23-9-15-5-7-16(8-6-15)36(22,28)29/h5-8,17-21,23H,9-10H2,1-4H3,(H2,22,28,29)/t17-,18-,19+,20-,21+/m1/s1 |
| InChIKey | KQNMOPGQUNRHLO-ADAARDCZSA-N |
| XLogP | 0.15 |
| TPSA | 186.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.59 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|