About 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine
6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine (PubChem CID 46197589) has the molecular formula C15H9ClN4S
and a molecular weight of 312.79 g/mol. Its IUPAC name is 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine.
Molecular Properties
| Compound Name | 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine |
| PubChem CID | 46197589 |
| Molecular Formula | C15H9ClN4S |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine |
| SMILES | Clc1ccc2nc(-c3cccs3)c(-c3ccncc3)n2n1 |
| InChI | InChI=1S/C15H9ClN4S/c16-12-3-4-13-18-14(11-2-1-9-21-11)15(20(13)19-12)10-5-7-17-8-6-10/h1-9H |
| InChIKey | IFNZYMJWRNJXAI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine?
The IUPAC name of 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine (CID 46197589) is 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine.
What is the SMILES notation for 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine?
The canonical SMILES for 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine is Clc1ccc2nc(-c3cccs3)c(-c3ccncc3)n2n1.
What is the InChIKey of 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine?
The InChIKey is IFNZYMJWRNJXAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9ClN4S/c16-12-3-4-13-18-14(11-2-1-9-21-11)15(20(13)19-12)10-5-7-17-8-6-10/h1-9H.
What are the key properties of 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine?
6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine has a molecular weight of 312.79 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3-pyridin-4-yl-2-thiophen-2-ylimidazo[1,2-b]pyridazine is sourced from PubChem (CID 46197589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).