C35H60O3Si — CID 46197734
CID 46197734 (PubChem CID 46197734) has the molecular formula C35H60O3Si and a molecular weight of 556.95 g/mol.
| Compound Name | CID 46197734 |
|---|---|
| PubChem CID | 46197734 |
| Molecular Formula | C35H60O3Si |
| Molecular Weight | 556.95 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | — |
| SMILES | C#C[C@@H]1O[C@H](CC[C@H](C)/C=C(\C)C[C@@H](C)C[C@H](C)C(=C)CO[C]C(=C)C)[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@H]1C |
| InChI | InChI=1S/C35H60O3Si/c1-14-33-31(12)35(38-39(15-2,16-3)17-4)32(13)34(37-33)19-18-26(7)20-27(8)21-28(9)22-29(10)30(11)24-36-23-25(5)6/h1,20,26,28-29,31-35H,5,11,15-19,21-22,24H2,2-4,6-10,12-13H3/b27-20+/t26-,28+,29-,31-,32-,33-,34+,35+/m0/s1 |
| InChIKey | NXOXLRCEFSLJOX-HRHTUXKOSA-N |
| XLogP | 9.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.95 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|