C13H20N2O9S2 — CID 46197792
(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-[(4-sulfamoylphenyl)methyl]oxane-2-sulfonamide (PubChem CID 46197792) has the molecular formula C13H20N2O9S2 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-[(4-sulfamoylphenyl)methyl]oxane-2-sulfonamide.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-[(4-sulfamoylphenyl)methyl]oxane-2-sulfonamide |
|---|---|
| PubChem CID | 46197792 |
| Molecular Formula | C13H20N2O9S2 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)-N-[(4-sulfamoylphenyl)methyl]oxane-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(CNS(=O)(=O)[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C13H20N2O9S2/c14-25(20,21)8-3-1-7(2-4-8)5-15-26(22,23)13-12(19)11(18)10(17)9(6-16)24-13/h1-4,9-13,15-19H,5-6H2,(H2,14,20,21)/t9-,10+,11+,12-,13+/m1/s1 |
| InChIKey | GQMYXUSHBXLGED-SJHCENCUSA-N |
| XLogP | -3.45 |
| TPSA | 196.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | -3.45 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |