About 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one
1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one (PubChem CID 46197850) has the molecular formula C21H13ClN2O2
and a molecular weight of 360.80 g/mol. Its IUPAC name is 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one.
Molecular Properties
| Compound Name | 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
| PubChem CID | 46197850 |
| Molecular Formula | C21H13ClN2O2 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one |
| SMILES | O=C1NC(c2cc3ccccc3nc2Cl)c2c(ccc3ccccc23)O1 |
| InChI | InChI=1S/C21H13ClN2O2/c22-20-15(11-13-6-2-4-8-16(13)23-20)19-18-14-7-3-1-5-12(14)9-10-17(18)26-21(25)24-19/h1-11,19H,(H,24,25) |
| InChIKey | HUSBVGKLAKNSDN-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The IUPAC name of 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one (CID 46197850) is 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one.
What is the SMILES notation for 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The canonical SMILES for 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one is O=C1NC(c2cc3ccccc3nc2Cl)c2c(ccc3ccccc23)O1.
What is the InChIKey of 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
The InChIKey is HUSBVGKLAKNSDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H13ClN2O2/c22-20-15(11-13-6-2-4-8-16(13)23-20)19-18-14-7-3-1-5-12(14)9-10-17(18)26-21(25)24-19/h1-11,19H,(H,24,25).
What are the key properties of 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one?
1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one has a molecular weight of 360.80 g/mol, XLogP of 5.23, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroquinolin-3-yl)-1,2-dihydrobenzo[f][1,3]benzoxazin-3-one is sourced from PubChem (CID 46197850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).