C27H24ClNO3 — CID 46198162
methyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate (PubChem CID 46198162) has the molecular formula C27H24ClNO3 and a molecular weight of 445.95 g/mol. Its IUPAC name is methyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 46198162 |
| Molecular Formula | C27H24ClNO3 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | methyl (2S,3R,4S,5R)-5-(4-chlorophenyl)-3-phenyl-4-[(E)-3-phenylprop-2-enoyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1N[C@@H](c2ccc(Cl)cc2)[C@@H](C(=O)/C=C/c2ccccc2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C27H24ClNO3/c1-32-27(31)26-23(19-10-6-3-7-11-19)24(22(30)17-12-18-8-4-2-5-9-18)25(29-26)20-13-15-21(28)16-14-20/h2-17,23-26,29H,1H3/b17-12+/t23-,24-,25-,26-/m0/s1 |
| InChIKey | OZUGLCFAIHINMI-TYAJCDGESA-N |
| XLogP | 5.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|