C18H13Cl2N3O — CID 46198191
(E)-1-[1-(2,5-dichlorophenyl)-5-methyltriazol-4-yl]-3-phenylprop-2-en-1-one (PubChem CID 46198191) has the molecular formula C18H13Cl2N3O and a molecular weight of 358.23 g/mol. Its IUPAC name is (E)-1-[1-(2,5-dichlorophenyl)-5-methyltriazol-4-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[1-(2,5-dichlorophenyl)-5-methyltriazol-4-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 46198191 |
| Molecular Formula | C18H13Cl2N3O |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | (E)-1-[1-(2,5-dichlorophenyl)-5-methyltriazol-4-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1c(C(=O)/C=C/c2ccccc2)nnn1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H13Cl2N3O/c1-12-18(17(24)10-7-13-5-3-2-4-6-13)21-22-23(12)16-11-14(19)8-9-15(16)20/h2-11H,1H3/b10-7+ |
| InChIKey | YTLDWDXDDZFJBZ-JXMROGBWSA-N |
| XLogP | 4.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|