C20H28F3NO6SSi — CID 46198222
benzyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate (PubChem CID 46198222) has the molecular formula C20H28F3NO6SSi and a molecular weight of 495.59 g/mol. Its IUPAC name is benzyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | benzyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 46198222 |
| Molecular Formula | C20H28F3NO6SSi |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | benzyl (2S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(trifluoromethylsulfonyloxy)-2,5-dihydropyrrole-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C=C(OS(=O)(=O)C(F)(F)F)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H28F3NO6SSi/c1-19(2,3)32(4,5)29-14-16-11-17(30-31(26,27)20(21,22)23)12-24(16)18(25)28-13-15-9-7-6-8-10-15/h6-11,16H,12-14H2,1-5H3/t16-/m0/s1 |
| InChIKey | SYVXAFDOGUFJJL-INIZCTEOSA-N |
| XLogP | 4.78 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|