About 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane
4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane (PubChem CID 46198949) has the molecular formula C25H24N4O5S2
and a molecular weight of 524.62 g/mol. Its IUPAC name is 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane |
| PubChem CID | 46198949 |
| Molecular Formula | C25H24N4O5S2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane |
| SMILES | O=S(=O)(c1cccc2cccnc12)N1CCC2(CC1)OCCN2S(=O)(=O)c1cccc2cccnc12 |
| InChI | InChI=1S/C25H24N4O5S2/c30-35(31,21-9-1-5-19-7-3-13-26-23(19)21)28-15-11-25(12-16-28)29(17-18-34-25)36(32,33)22-10-2-6-20-8-4-14-27-24(20)22/h1-10,13-14H,11-12,15-18H2 |
| InChIKey | WFLMYNVEPQECQY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane?
The IUPAC name of 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane (CID 46198949) is 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane.
What is the SMILES notation for 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane?
The canonical SMILES for 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane is O=S(=O)(c1cccc2cccnc12)N1CCC2(CC1)OCCN2S(=O)(=O)c1cccc2cccnc12.
What is the InChIKey of 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane?
The InChIKey is WFLMYNVEPQECQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N4O5S2/c30-35(31,21-9-1-5-19-7-3-13-26-23(19)21)28-15-11-25(12-16-28)29(17-18-34-25)36(32,33)22-10-2-6-20-8-4-14-27-24(20)22/h1-10,13-14H,11-12,15-18H2.
What are the key properties of 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane?
4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane has a molecular weight of 524.62 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,8-bis(quinolin-8-ylsulfonyl)-1-oxa-4,8-diazaspiro[4.5]decane is sourced from PubChem (CID 46198949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).